About chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate
chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate (PubChem CID 174561260) has the molecular formula C4H10AlClN4O4
and a molecular weight of 240.58 g/mol. Its IUPAC name is chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate.
Molecular Properties
| Compound Name | chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate |
| PubChem CID | 174561260 |
| Molecular Formula | C4H10AlClN4O4 |
| Molecular Weight | 240.58 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate |
| SMILES | NC(=O)NC1NC(=O)NC1=O.O.[AlH2]Cl |
| InChI | InChI=1S/C4H6N4O3.Al.ClH.H2O.2H/c5-3(10)6-1-2(9)8-4(11)7-1;;;;;/h1H,(H3,5,6,10)(H2,7,8,9,11);;1H;1H2;;/q;+1;;;;/p-1 |
| InChIKey | FZNMAXBAMYHLRV-UHFFFAOYSA-M |
| XLogP | -3.23 |
| TPSA | 144.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.58 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate?
The IUPAC name of chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate (CID 174561260) is chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate.
What is the SMILES notation for chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate?
The canonical SMILES for chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate is NC(=O)NC1NC(=O)NC1=O.O.[AlH2]Cl.
What is the InChIKey of chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate?
The InChIKey is FZNMAXBAMYHLRV-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6N4O3.Al.ClH.H2O.2H/c5-3(10)6-1-2(9)8-4(11)7-1;;;;;/h1H,(H3,5,6,10)(H2,7,8,9,11);;1H;1H2;;/q;+1;;;;/p-1.
What are the key properties of chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate?
chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate has a molecular weight of 240.58 g/mol, XLogP of -3.23, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloroalumane;(2,5-dioxoimidazolidin-4-yl)urea;hydrate is sourced from PubChem (CID 174561260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).