About 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde
2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde (PubChem CID 174561348) has the molecular formula C9H12BrNO5S
and a molecular weight of 326.17 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde |
| PubChem CID | 174561348 |
| Molecular Formula | C9H12BrNO5S |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde |
| SMILES | NCCS(=O)(=O)O.O=Cc1cc(Br)ccc1O |
| InChI | InChI=1S/C7H5BrO2.C2H7NO3S/c8-6-1-2-7(10)5(3-6)4-9;3-1-2-7(4,5)6/h1-4,10H;1-3H2,(H,4,5,6) |
| InChIKey | MZUZZNVBKKXGSK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde?
The IUPAC name of 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde (CID 174561348) is 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde.
What is the SMILES notation for 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde?
The canonical SMILES for 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde is NCCS(=O)(=O)O.O=Cc1cc(Br)ccc1O.
What is the InChIKey of 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde?
The InChIKey is MZUZZNVBKKXGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2.C2H7NO3S/c8-6-1-2-7(10)5(3-6)4-9;3-1-2-7(4,5)6/h1-4,10H;1-3H2,(H,4,5,6).
What are the key properties of 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde?
2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde has a molecular weight of 326.17 g/mol, XLogP of 0.80, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanesulfonic acid;5-bromo-2-hydroxybenzaldehyde is sourced from PubChem (CID 174561348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).