4-bromobenzenesulfonyl chloride

C12H8Br2Cl2O4S2 — CID 174561770

IUPAC4-bromobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Br)cc1.O=S(=O)(Cl)c1ccc(Br)cc1
InChIInChI=1S/2C6H4BrClO2S/c2*7-5-1-3-6(4-2-5)11(8,9)10/h2*1-4H
InChIKeyLNPAWPJSSVIYHQ-UHFFFAOYSA-N
MW511.04 g/mol
LogP4.75
Rot. Bonds2

About 4-bromobenzenesulfonyl chloride

4-bromobenzenesulfonyl chloride (PubChem CID 174561770) has the molecular formula C12H8Br2Cl2O4S2 and a molecular weight of 511.04 g/mol. Its IUPAC name is 4-bromobenzenesulfonyl chloride.

Molecular Properties

Compound Name4-bromobenzenesulfonyl chloride
PubChem CID174561770
Molecular FormulaC12H8Br2Cl2O4S2
Molecular Weight511.04 g/mol
Exact Mass507.76
IUPAC Name4-bromobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(Br)cc1.O=S(=O)(Cl)c1ccc(Br)cc1
InChIInChI=1S/2C6H4BrClO2S/c2*7-5-1-3-6(4-2-5)11(8,9)10/h2*1-4H
InChIKeyLNPAWPJSSVIYHQ-UHFFFAOYSA-N
XLogP4.75
TPSA68.28 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500511.04
LogP ≤ 54.75
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-bromobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromobenzenesulfonyl chloride?
The IUPAC name of 4-bromobenzenesulfonyl chloride (CID 174561770) is 4-bromobenzenesulfonyl chloride.
What is the SMILES notation for 4-bromobenzenesulfonyl chloride?
The canonical SMILES for 4-bromobenzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(Br)cc1.O=S(=O)(Cl)c1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzenesulfonyl chloride?
The InChIKey is LNPAWPJSSVIYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4BrClO2S/c2*7-5-1-3-6(4-2-5)11(8,9)10/h2*1-4H.
What are the key properties of 4-bromobenzenesulfonyl chloride?
4-bromobenzenesulfonyl chloride has a molecular weight of 511.04 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzenesulfonyl chloride is sourced from PubChem (CID 174561770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).