About 4-bromobenzenesulfonyl chloride
4-bromobenzenesulfonyl chloride (PubChem CID 174561770) has the molecular formula C12H8Br2Cl2O4S2
and a molecular weight of 511.04 g/mol. Its IUPAC name is 4-bromobenzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-bromobenzenesulfonyl chloride |
| PubChem CID | 174561770 |
| Molecular Formula | C12H8Br2Cl2O4S2 |
| Molecular Weight | 511.04 g/mol |
| Exact Mass | 507.76 |
| IUPAC Name | 4-bromobenzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(Br)cc1.O=S(=O)(Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/2C6H4BrClO2S/c2*7-5-1-3-6(4-2-5)11(8,9)10/h2*1-4H |
| InChIKey | LNPAWPJSSVIYHQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.04 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-bromobenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromobenzenesulfonyl chloride?
The IUPAC name of 4-bromobenzenesulfonyl chloride (CID 174561770) is 4-bromobenzenesulfonyl chloride.
What is the SMILES notation for 4-bromobenzenesulfonyl chloride?
The canonical SMILES for 4-bromobenzenesulfonyl chloride is O=S(=O)(Cl)c1ccc(Br)cc1.O=S(=O)(Cl)c1ccc(Br)cc1.
What is the InChIKey of 4-bromobenzenesulfonyl chloride?
The InChIKey is LNPAWPJSSVIYHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H4BrClO2S/c2*7-5-1-3-6(4-2-5)11(8,9)10/h2*1-4H.
What are the key properties of 4-bromobenzenesulfonyl chloride?
4-bromobenzenesulfonyl chloride has a molecular weight of 511.04 g/mol, XLogP of 4.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromobenzenesulfonyl chloride is sourced from PubChem (CID 174561770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).