C18H27NO4 — CID 174561807
tert-butyl 3-(hydroxymethyl)-2-imino-5-[(3-methylphenyl)methoxy]pentanoate (PubChem CID 174561807) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl 3-(hydroxymethyl)-2-imino-5-[(3-methylphenyl)methoxy]pentanoate.
| Compound Name | tert-butyl 3-(hydroxymethyl)-2-imino-5-[(3-methylphenyl)methoxy]pentanoate |
|---|---|
| PubChem CID | 174561807 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl 3-(hydroxymethyl)-2-imino-5-[(3-methylphenyl)methoxy]pentanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)C(CO)CCOCc1cccc(C)c1 |
| InChI | InChI=1S/C18H27NO4/c1-13-6-5-7-14(10-13)12-22-9-8-15(11-20)16(19)17(21)23-18(2,3)4/h5-7,10,15,19-20H,8-9,11-12H2,1-4H3/b19-16- |
| InChIKey | YKSGPSGXTNFTLB-MNDPQUGUSA-N |
| XLogP | 2.87 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|