About 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid
1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid (PubChem CID 174561950) has the molecular formula C15H28O5
and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid.
Molecular Properties
| Compound Name | 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid |
| PubChem CID | 174561950 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid |
| SMILES | CC(=O)C1(C)CCC(C(C)C)C(O)C1.CC(O)C(=O)O |
| InChI | InChI=1S/C12H22O2.C3H6O3/c1-8(2)10-5-6-12(4,9(3)13)7-11(10)14;1-2(4)3(5)6/h8,10-11,14H,5-7H2,1-4H3;2,4H,1H3,(H,5,6) |
| InChIKey | HZJKSZYGNOBVEW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid?
The IUPAC name of 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid (CID 174561950) is 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid.
What is the SMILES notation for 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid?
The canonical SMILES for 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid is CC(=O)C1(C)CCC(C(C)C)C(O)C1.CC(O)C(=O)O.
What is the InChIKey of 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid?
The InChIKey is HZJKSZYGNOBVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2.C3H6O3/c1-8(2)10-5-6-12(4,9(3)13)7-11(10)14;1-2(4)3(5)6/h8,10-11,14H,5-7H2,1-4H3;2,4H,1H3,(H,5,6).
What are the key properties of 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid?
1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid has a molecular weight of 288.38 g/mol, XLogP of 1.85, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxy-1-methyl-4-propan-2-ylcyclohexyl)ethanone;2-hydroxypropanoic acid is sourced from PubChem (CID 174561950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).