About 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole
3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole (PubChem CID 174562005) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole |
| PubChem CID | 174562005 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole |
| SMILES | c1cc(CCc2cncs2)no1 |
| InChI | InChI=1S/C8H8N2OS/c1(7-3-4-11-10-7)2-8-5-9-6-12-8/h3-6H,1-2H2 |
| InChIKey | MWOZTMPCXHHKGK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole?
The IUPAC name of 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole (CID 174562005) is 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole.
What is the SMILES notation for 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole?
The canonical SMILES for 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole is c1cc(CCc2cncs2)no1.
What is the InChIKey of 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole?
The InChIKey is MWOZTMPCXHHKGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c1(7-3-4-11-10-7)2-8-5-9-6-12-8/h3-6H,1-2H2.
What are the key properties of 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole?
3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole has a molecular weight of 180.23 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,3-thiazol-5-yl)ethyl]-1,2-oxazole is sourced from PubChem (CID 174562005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).