C14H18FNO2S — CID 174562699
2-butyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 174562699) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-butyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-butyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 174562699 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-butyl-2-(3-fluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCC1(c2cccc(F)c2)NC(C(=O)O)CS1 |
| InChI | InChI=1S/C14H18FNO2S/c1-2-3-7-14(10-5-4-6-11(15)8-10)16-12(9-19-14)13(17)18/h4-6,8,12,16H,2-3,7,9H2,1H3,(H,17,18) |
| InChIKey | LXHAZCMZWRFLOW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |