About [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate
[4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate (PubChem CID 174563475) has the molecular formula C20H14FN3O6
and a molecular weight of 411.35 g/mol. Its IUPAC name is [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate.
Molecular Properties
| Compound Name | [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate |
| PubChem CID | 174563475 |
| Molecular Formula | C20H14FN3O6 |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate |
| SMILES | Cc1cnc(F)c(-c2c([N+](=O)[O-])cc(COC(=O)c3ccccc3)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14FN3O6/c1-12-7-15(19(21)22-10-12)18-16(23(26)27)8-13(9-17(18)24(28)29)11-30-20(25)14-5-3-2-4-6-14/h2-10H,11H2,1H3 |
| InChIKey | XRYQMOXCNFRJCK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 125.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate?
The IUPAC name of [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate (CID 174563475) is [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate.
What is the SMILES notation for [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate?
The canonical SMILES for [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate is Cc1cnc(F)c(-c2c([N+](=O)[O-])cc(COC(=O)c3ccccc3)cc2[N+](=O)[O-])c1.
What is the InChIKey of [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate?
The InChIKey is XRYQMOXCNFRJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN3O6/c1-12-7-15(19(21)22-10-12)18-16(23(26)27)8-13(9-17(18)24(28)29)11-30-20(25)14-5-3-2-4-6-14/h2-10H,11H2,1H3.
What are the key properties of [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate?
[4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate has a molecular weight of 411.35 g/mol, XLogP of 4.37, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-fluoro-5-methyl-3-pyridinyl)-3,5-dinitrophenyl]methyl benzoate is sourced from PubChem (CID 174563475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).