C30H32N2O8S — CID 174564082
1,3,6,7-tetramethoxy-4-[1-(3-phenylpiperazin-1-yl)prop-2-enylsulfonyl]xanthen-9-one (PubChem CID 174564082) has the molecular formula C30H32N2O8S and a molecular weight of 580.66 g/mol. Its IUPAC name is 1,3,6,7-tetramethoxy-4-[1-(3-phenylpiperazin-1-yl)prop-2-enylsulfonyl]xanthen-9-one.
| Compound Name | 1,3,6,7-tetramethoxy-4-[1-(3-phenylpiperazin-1-yl)prop-2-enylsulfonyl]xanthen-9-one |
|---|---|
| PubChem CID | 174564082 |
| Molecular Formula | C30H32N2O8S |
| Molecular Weight | 580.66 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 1,3,6,7-tetramethoxy-4-[1-(3-phenylpiperazin-1-yl)prop-2-enylsulfonyl]xanthen-9-one |
| SMILES | C=CC(N1CCNC(c2ccccc2)C1)S(=O)(=O)c1c(OC)cc(OC)c2c(=O)c3cc(OC)c(OC)cc3oc12 |
| InChI | InChI=1S/C30H32N2O8S/c1-6-26(32-13-12-31-20(17-32)18-10-8-7-9-11-18)41(34,35)30-25(39-5)16-24(38-4)27-28(33)19-14-22(36-2)23(37-3)15-21(19)40-29(27)30/h6-11,14-16,20,26,31H,1,12-13,17H2,2-5H3 |
| InChIKey | GZRKSHCRMBFPSJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|