C24H22FNO9S — CID 174564084
[4-[(4-fluorophenyl)methyl]-1,3,6,7-tetramethoxy-9-oxoxanthen-2-yl]sulfamic acid (PubChem CID 174564084) has the molecular formula C24H22FNO9S and a molecular weight of 519.50 g/mol. Its IUPAC name is [4-[(4-fluorophenyl)methyl]-1,3,6,7-tetramethoxy-9-oxoxanthen-2-yl]sulfamic acid.
| Compound Name | [4-[(4-fluorophenyl)methyl]-1,3,6,7-tetramethoxy-9-oxoxanthen-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 174564084 |
| Molecular Formula | C24H22FNO9S |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | [4-[(4-fluorophenyl)methyl]-1,3,6,7-tetramethoxy-9-oxoxanthen-2-yl]sulfamic acid |
| SMILES | COc1cc2oc3c(Cc4ccc(F)cc4)c(OC)c(NS(=O)(=O)O)c(OC)c3c(=O)c2cc1OC |
| InChI | InChI=1S/C24H22FNO9S/c1-31-17-10-14-16(11-18(17)32-2)35-22-15(9-12-5-7-13(25)8-6-12)23(33-3)20(26-36(28,29)30)24(34-4)19(22)21(14)27/h5-8,10-11,26H,9H2,1-4H3,(H,28,29,30) |
| InChIKey | RVKGHYICCNNMDG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|