About zinc;trichloroalumane;sulfate
zinc;trichloroalumane;sulfate (PubChem CID 174566235) has the molecular formula AlCl3O4SZn
and a molecular weight of 294.79 g/mol. Its IUPAC name is zinc;trichloroalumane;sulfate.
Molecular Properties
| Compound Name | zinc;trichloroalumane;sulfate |
| PubChem CID | 174566235 |
| Molecular Formula | AlCl3O4SZn |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 291.77 |
| IUPAC Name | zinc;trichloroalumane;sulfate |
| SMILES | Cl[Al](Cl)Cl.O=S(=O)([O-])[O-].[Zn+2] |
| InChI | InChI=1S/Al.3ClH.H2O4S.Zn/c;;;;1-5(2,3)4;/h;3*1H;(H2,1,2,3,4);/q+3;;;;;+2/p-5 |
| InChIKey | GUCDVKHGQRPPEX-UHFFFAOYSA-I |
| XLogP | 0.35 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;trichloroalumane;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;trichloroalumane;sulfate?
The IUPAC name of zinc;trichloroalumane;sulfate (CID 174566235) is zinc;trichloroalumane;sulfate.
What is the SMILES notation for zinc;trichloroalumane;sulfate?
The canonical SMILES for zinc;trichloroalumane;sulfate is Cl[Al](Cl)Cl.O=S(=O)([O-])[O-].[Zn+2].
What is the InChIKey of zinc;trichloroalumane;sulfate?
The InChIKey is GUCDVKHGQRPPEX-UHFFFAOYSA-I. The full InChI is InChI=1S/Al.3ClH.H2O4S.Zn/c;;;;1-5(2,3)4;/h;3*1H;(H2,1,2,3,4);/q+3;;;;;+2/p-5.
What are the key properties of zinc;trichloroalumane;sulfate?
zinc;trichloroalumane;sulfate has a molecular weight of 294.79 g/mol, XLogP of 0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;trichloroalumane;sulfate is sourced from PubChem (CID 174566235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).