About 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene
1-(pentylamino)propane-2-sulfonic acid;prop-1-ene (PubChem CID 174566771) has the molecular formula C11H25NO3S
and a molecular weight of 251.39 g/mol. Its IUPAC name is 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene.
Molecular Properties
| Compound Name | 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene |
| PubChem CID | 174566771 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene |
| SMILES | C=CC.CCCCCNCC(C)S(=O)(=O)O |
| InChI | InChI=1S/C8H19NO3S.C3H6/c1-3-4-5-6-9-7-8(2)13(10,11)12;1-3-2/h8-9H,3-7H2,1-2H3,(H,10,11,12);3H,1H2,2H3 |
| InChIKey | FFDYEDYSSXWHFK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene?
The IUPAC name of 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene (CID 174566771) is 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene.
What is the SMILES notation for 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene?
The canonical SMILES for 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene is C=CC.CCCCCNCC(C)S(=O)(=O)O.
What is the InChIKey of 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene?
The InChIKey is FFDYEDYSSXWHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S.C3H6/c1-3-4-5-6-9-7-8(2)13(10,11)12;1-3-2/h8-9H,3-7H2,1-2H3,(H,10,11,12);3H,1H2,2H3.
What are the key properties of 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene?
1-(pentylamino)propane-2-sulfonic acid;prop-1-ene has a molecular weight of 251.39 g/mol, XLogP of 2.23, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(pentylamino)propane-2-sulfonic acid;prop-1-ene is sourced from PubChem (CID 174566771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).