About cobalt;21,22-dihydroporphyrin;1-phenylethanone
cobalt;21,22-dihydroporphyrin;1-phenylethanone (PubChem CID 174566925) has the molecular formula C28H21CoN4O-
and a molecular weight of 488.44 g/mol. Its IUPAC name is cobalt;21,22-dihydroporphyrin;1-phenylethanone.
Molecular Properties
| Compound Name | cobalt;21,22-dihydroporphyrin;1-phenylethanone |
| PubChem CID | 174566925 |
| Molecular Formula | C28H21CoN4O- |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | cobalt;21,22-dihydroporphyrin;1-phenylethanone |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CC(=O)c1[c-]cccc1.[Co] |
| InChI | InChI=1S/C20H14N4.C8H7O.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-7(9)8-5-3-2-4-6-8;/h1-12,21-22H;2-5H,1H3;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | TVMCBYZUMVQCPG-IAULSPAKSA-N |
| XLogP | 6.34 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cobalt;21,22-dihydroporphyrin;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;21,22-dihydroporphyrin;1-phenylethanone?
The IUPAC name of cobalt;21,22-dihydroporphyrin;1-phenylethanone (CID 174566925) is cobalt;21,22-dihydroporphyrin;1-phenylethanone.
What is the SMILES notation for cobalt;21,22-dihydroporphyrin;1-phenylethanone?
The canonical SMILES for cobalt;21,22-dihydroporphyrin;1-phenylethanone is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.CC(=O)c1[c-]cccc1.[Co].
What is the InChIKey of cobalt;21,22-dihydroporphyrin;1-phenylethanone?
The InChIKey is TVMCBYZUMVQCPG-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.C8H7O.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-7(9)8-5-3-2-4-6-8;/h1-12,21-22H;2-5H,1H3;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of cobalt;21,22-dihydroporphyrin;1-phenylethanone?
cobalt;21,22-dihydroporphyrin;1-phenylethanone has a molecular weight of 488.44 g/mol, XLogP of 6.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;21,22-dihydroporphyrin;1-phenylethanone is sourced from PubChem (CID 174566925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).