C16H23NRu — CID 174567272
1-prop-2-enylcyclopenta-1,3-diene;ruthenium;2,3,4,5-tetramethyl-1H-pyrrole (PubChem CID 174567272) has the molecular formula C16H23NRu and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-prop-2-enylcyclopenta-1,3-diene;ruthenium;2,3,4,5-tetramethyl-1H-pyrrole.
| Compound Name | 1-prop-2-enylcyclopenta-1,3-diene;ruthenium;2,3,4,5-tetramethyl-1H-pyrrole |
|---|---|
| PubChem CID | 174567272 |
| Molecular Formula | C16H23NRu |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 1-prop-2-enylcyclopenta-1,3-diene;ruthenium;2,3,4,5-tetramethyl-1H-pyrrole |
| SMILES | C=CCC1=CC=CC1.Cc1[nH]c(C)c(C)c1C.[Ru] |
| InChI | InChI=1S/C8H13N.C8H10.Ru/c1-5-6(2)8(4)9-7(5)3;1-2-5-8-6-3-4-7-8;/h9H,1-4H3;2-4,6H,1,5,7H2; |
| InChIKey | TYPWDFLDCVKNRQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|