About N-hydroxyprop-2-enamide;prop-2-enamide
N-hydroxyprop-2-enamide;prop-2-enamide (PubChem CID 174568103) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is N-hydroxyprop-2-enamide;prop-2-enamide.
Molecular Properties
| Compound Name | N-hydroxyprop-2-enamide;prop-2-enamide |
| PubChem CID | 174568103 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | N-hydroxyprop-2-enamide;prop-2-enamide |
| SMILES | C=CC(=O)NO.C=CC(N)=O |
| InChI | InChI=1S/C3H5NO2.C3H5NO/c1-2-3(5)4-6;1-2-3(4)5/h2,6H,1H2,(H,4,5);2H,1H2,(H2,4,5) |
| InChIKey | UNOGTUHLNHOWQY-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxyprop-2-enamide;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxyprop-2-enamide;prop-2-enamide?
The IUPAC name of N-hydroxyprop-2-enamide;prop-2-enamide (CID 174568103) is N-hydroxyprop-2-enamide;prop-2-enamide.
What is the SMILES notation for N-hydroxyprop-2-enamide;prop-2-enamide?
The canonical SMILES for N-hydroxyprop-2-enamide;prop-2-enamide is C=CC(=O)NO.C=CC(N)=O.
What is the InChIKey of N-hydroxyprop-2-enamide;prop-2-enamide?
The InChIKey is UNOGTUHLNHOWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.C3H5NO/c1-2-3(5)4-6;1-2-3(4)5/h2,6H,1H2,(H,4,5);2H,1H2,(H2,4,5).
What are the key properties of N-hydroxyprop-2-enamide;prop-2-enamide?
N-hydroxyprop-2-enamide;prop-2-enamide has a molecular weight of 158.16 g/mol, XLogP of -0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxyprop-2-enamide;prop-2-enamide is sourced from PubChem (CID 174568103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).