About cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene
cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene (PubChem CID 174568415) has the molecular formula C11H12Co
and a molecular weight of 203.15 g/mol. Its IUPAC name is cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene |
| PubChem CID | 174568415 |
| Molecular Formula | C11H12Co |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene |
| SMILES | CC1C=CC=C1C1=CC=CC1.[Co] |
| InChI | InChI=1S/C11H12.Co/c1-9-5-4-8-11(9)10-6-2-3-7-10;/h2-6,8-9H,7H2,1H3; |
| InChIKey | UVLWORMFFDAVRD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene?
The IUPAC name of cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene (CID 174568415) is cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene.
What is the SMILES notation for cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene?
The canonical SMILES for cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene is CC1C=CC=C1C1=CC=CC1.[Co].
What is the InChIKey of cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene?
The InChIKey is UVLWORMFFDAVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12.Co/c1-9-5-4-8-11(9)10-6-2-3-7-10;/h2-6,8-9H,7H2,1H3;.
What are the key properties of cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene?
cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene has a molecular weight of 203.15 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;1-cyclopenta-1,3-dien-1-yl-5-methylcyclopenta-1,3-diene is sourced from PubChem (CID 174568415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).