C10H11FN2O4S — CID 174569002
5-(2-fluoro-6-hydroxy-4-methylphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde (PubChem CID 174569002) has the molecular formula C10H11FN2O4S and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-(2-fluoro-6-hydroxy-4-methylphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde.
| Compound Name | 5-(2-fluoro-6-hydroxy-4-methylphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 174569002 |
| Molecular Formula | C10H11FN2O4S |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 5-(2-fluoro-6-hydroxy-4-methylphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
| SMILES | Cc1cc(O)c(N2CC(C=O)NS2(=O)=O)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O4S/c1-6-2-8(11)10(9(15)3-6)13-4-7(5-14)12-18(13,16)17/h2-3,5,7,12,15H,4H2,1H3 |
| InChIKey | SOWLGFCXVHYIKF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|