About amino(methyl)carbamic acid;hydrate
amino(methyl)carbamic acid;hydrate (PubChem CID 174569460) has the molecular formula C2H8N2O3
and a molecular weight of 108.10 g/mol. Its IUPAC name is amino(methyl)carbamic acid;hydrate.
Molecular Properties
| Compound Name | amino(methyl)carbamic acid;hydrate |
| PubChem CID | 174569460 |
| Molecular Formula | C2H8N2O3 |
| Molecular Weight | 108.10 g/mol |
| Exact Mass | 108.05 |
| IUPAC Name | amino(methyl)carbamic acid;hydrate |
| SMILES | CN(N)C(=O)O.O |
| InChI | InChI=1S/C2H6N2O2.H2O/c1-4(3)2(5)6;/h3H2,1H3,(H,5,6);1H2 |
| InChIKey | BBUHIAUGWIEJAP-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.10 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino(methyl)carbamic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino(methyl)carbamic acid;hydrate?
The IUPAC name of amino(methyl)carbamic acid;hydrate (CID 174569460) is amino(methyl)carbamic acid;hydrate.
What is the SMILES notation for amino(methyl)carbamic acid;hydrate?
The canonical SMILES for amino(methyl)carbamic acid;hydrate is CN(N)C(=O)O.O.
What is the InChIKey of amino(methyl)carbamic acid;hydrate?
The InChIKey is BBUHIAUGWIEJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2.H2O/c1-4(3)2(5)6;/h3H2,1H3,(H,5,6);1H2.
What are the key properties of amino(methyl)carbamic acid;hydrate?
amino(methyl)carbamic acid;hydrate has a molecular weight of 108.10 g/mol, XLogP of -1.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for amino(methyl)carbamic acid;hydrate is sourced from PubChem (CID 174569460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).