About cyclohexa-2,4-diene-1,1-diamine;methanamine
cyclohexa-2,4-diene-1,1-diamine;methanamine (PubChem CID 174570033) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is cyclohexa-2,4-diene-1,1-diamine;methanamine.
Molecular Properties
| Compound Name | cyclohexa-2,4-diene-1,1-diamine;methanamine |
| PubChem CID | 174570033 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | cyclohexa-2,4-diene-1,1-diamine;methanamine |
| SMILES | CN.NC1(N)C=CC=CC1 |
| InChI | InChI=1S/C6H10N2.CH5N/c7-6(8)4-2-1-3-5-6;1-2/h1-4H,5,7-8H2;2H2,1H3 |
| InChIKey | MOIHERQMKUNMPN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-2,4-diene-1,1-diamine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-2,4-diene-1,1-diamine;methanamine?
The IUPAC name of cyclohexa-2,4-diene-1,1-diamine;methanamine (CID 174570033) is cyclohexa-2,4-diene-1,1-diamine;methanamine.
What is the SMILES notation for cyclohexa-2,4-diene-1,1-diamine;methanamine?
The canonical SMILES for cyclohexa-2,4-diene-1,1-diamine;methanamine is CN.NC1(N)C=CC=CC1.
What is the InChIKey of cyclohexa-2,4-diene-1,1-diamine;methanamine?
The InChIKey is MOIHERQMKUNMPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.CH5N/c7-6(8)4-2-1-3-5-6;1-2/h1-4H,5,7-8H2;2H2,1H3.
What are the key properties of cyclohexa-2,4-diene-1,1-diamine;methanamine?
cyclohexa-2,4-diene-1,1-diamine;methanamine has a molecular weight of 141.22 g/mol, XLogP of -0.31, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-2,4-diene-1,1-diamine;methanamine is sourced from PubChem (CID 174570033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).