About 2-chloro-3,5-dimethylpyridine;hydrochloride
2-chloro-3,5-dimethylpyridine;hydrochloride (PubChem CID 174570107) has the molecular formula C7H9Cl2N
and a molecular weight of 178.06 g/mol. Its IUPAC name is 2-chloro-3,5-dimethylpyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-3,5-dimethylpyridine;hydrochloride |
| PubChem CID | 174570107 |
| Molecular Formula | C7H9Cl2N |
| Molecular Weight | 178.06 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | 2-chloro-3,5-dimethylpyridine;hydrochloride |
| SMILES | Cc1cnc(Cl)c(C)c1.Cl |
| InChI | InChI=1S/C7H8ClN.ClH/c1-5-3-6(2)7(8)9-4-5;/h3-4H,1-2H3;1H |
| InChIKey | MHDOXPZLIWVQPA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.06 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3,5-dimethylpyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3,5-dimethylpyridine;hydrochloride?
The IUPAC name of 2-chloro-3,5-dimethylpyridine;hydrochloride (CID 174570107) is 2-chloro-3,5-dimethylpyridine;hydrochloride.
What is the SMILES notation for 2-chloro-3,5-dimethylpyridine;hydrochloride?
The canonical SMILES for 2-chloro-3,5-dimethylpyridine;hydrochloride is Cc1cnc(Cl)c(C)c1.Cl.
What is the InChIKey of 2-chloro-3,5-dimethylpyridine;hydrochloride?
The InChIKey is MHDOXPZLIWVQPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.ClH/c1-5-3-6(2)7(8)9-4-5;/h3-4H,1-2H3;1H.
What are the key properties of 2-chloro-3,5-dimethylpyridine;hydrochloride?
2-chloro-3,5-dimethylpyridine;hydrochloride has a molecular weight of 178.06 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3,5-dimethylpyridine;hydrochloride is sourced from PubChem (CID 174570107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).