C13H12ClF3N4S — CID 17457054
3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 17457054) has the molecular formula C13H12ClF3N4S and a molecular weight of 348.78 g/mol. Its IUPAC name is 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 17457054 |
| Molecular Formula | C13H12ClF3N4S |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | FC(F)(F)c1cnc(Sc2nnc3n2CCCCC3)c(Cl)c1 |
| InChI | InChI=1S/C13H12ClF3N4S/c14-9-6-8(13(15,16)17)7-18-11(9)22-12-20-19-10-4-2-1-3-5-21(10)12/h6-7H,1-5H2 |
| InChIKey | SIWCOBGSVZYWRY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |