About sodium;chlorosulfonyloxybenzene;hydride
sodium;chlorosulfonyloxybenzene;hydride (PubChem CID 174571400) has the molecular formula C6H6ClNaO3S
and a molecular weight of 216.62 g/mol. Its IUPAC name is sodium;chlorosulfonyloxybenzene;hydride.
Molecular Properties
| Compound Name | sodium;chlorosulfonyloxybenzene;hydride |
| PubChem CID | 174571400 |
| Molecular Formula | C6H6ClNaO3S |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | sodium;chlorosulfonyloxybenzene;hydride |
| SMILES | O=S(=O)(Cl)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C6H5ClO3S.Na.H/c7-11(8,9)10-6-4-2-1-3-5-6;;/h1-5H;;/q;+1;-1 |
| InChIKey | SVHMWURBNBAODH-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;chlorosulfonyloxybenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chlorosulfonyloxybenzene;hydride?
The IUPAC name of sodium;chlorosulfonyloxybenzene;hydride (CID 174571400) is sodium;chlorosulfonyloxybenzene;hydride.
What is the SMILES notation for sodium;chlorosulfonyloxybenzene;hydride?
The canonical SMILES for sodium;chlorosulfonyloxybenzene;hydride is O=S(=O)(Cl)Oc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;chlorosulfonyloxybenzene;hydride?
The InChIKey is SVHMWURBNBAODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO3S.Na.H/c7-11(8,9)10-6-4-2-1-3-5-6;;/h1-5H;;/q;+1;-1.
What are the key properties of sodium;chlorosulfonyloxybenzene;hydride?
sodium;chlorosulfonyloxybenzene;hydride has a molecular weight of 216.62 g/mol, XLogP of -1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chlorosulfonyloxybenzene;hydride is sourced from PubChem (CID 174571400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).