About 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate
1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate (PubChem CID 174572211) has the molecular formula C11H14BrNO2
and a molecular weight of 272.14 g/mol. Its IUPAC name is 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate.
Molecular Properties
| Compound Name | 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate |
| PubChem CID | 174572211 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate |
| SMILES | Cc1cc(Br)cc(C)c1C(C)OC(N)=O |
| InChI | InChI=1S/C11H14BrNO2/c1-6-4-9(12)5-7(2)10(6)8(3)15-11(13)14/h4-5,8H,1-3H3,(H2,13,14) |
| InChIKey | XWEUXJKBMUIONO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate?
The IUPAC name of 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate (CID 174572211) is 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate.
What is the SMILES notation for 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate?
The canonical SMILES for 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate is Cc1cc(Br)cc(C)c1C(C)OC(N)=O.
What is the InChIKey of 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate?
The InChIKey is XWEUXJKBMUIONO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrNO2/c1-6-4-9(12)5-7(2)10(6)8(3)15-11(13)14/h4-5,8H,1-3H3,(H2,13,14).
What are the key properties of 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate?
1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate has a molecular weight of 272.14 g/mol, XLogP of 3.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-2,6-dimethylphenyl)ethyl carbamate is sourced from PubChem (CID 174572211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).