About 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene
2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene (PubChem CID 174573028) has the molecular formula C16H17O3P
and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene |
| PubChem CID | 174573028 |
| Molecular Formula | C16H17O3P |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.O=Cc1ccccc1OP=O |
| InChI | InChI=1S/C9H12.C7H5O3P/c1-7-4-8(2)6-9(3)5-7;8-5-6-3-1-2-4-7(6)10-11-9/h4-6H,1-3H3;1-5H |
| InChIKey | CQROKYVZQTXBSC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene?
The IUPAC name of 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene (CID 174573028) is 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene.
What is the SMILES notation for 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene?
The canonical SMILES for 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.O=Cc1ccccc1OP=O.
What is the InChIKey of 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene?
The InChIKey is CQROKYVZQTXBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C7H5O3P/c1-7-4-8(2)6-9(3)5-7;8-5-6-3-1-2-4-7(6)10-11-9/h4-6H,1-3H3;1-5H.
What are the key properties of 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene?
2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene has a molecular weight of 288.28 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphorosooxybenzaldehyde;1,3,5-trimethylbenzene is sourced from PubChem (CID 174573028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).