C13H17N3 — CID 174573107
4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine (PubChem CID 174573107) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 174573107 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine |
| SMILES | CNc1ccccc1C1(N)C=CC(N)=CC1 |
| InChI | InChI=1S/C13H17N3/c1-16-12-5-3-2-4-11(12)13(15)8-6-10(14)7-9-13/h2-8,16H,9,14-15H2,1H3 |
| InChIKey | ZZHGCGVANHNALI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |