About 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine
4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine (PubChem CID 174573107) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 174573107 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine |
| SMILES | CNc1ccccc1C1(N)C=CC(N)=CC1 |
| InChI | InChI=1S/C13H17N3/c1-16-12-5-3-2-4-11(12)13(15)8-6-10(14)7-9-13/h2-8,16H,9,14-15H2,1H3 |
| InChIKey | ZZHGCGVANHNALI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine (CID 174573107) is 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine is CNc1ccccc1C1(N)C=CC(N)=CC1.
What is the InChIKey of 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine?
The InChIKey is ZZHGCGVANHNALI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-16-12-5-3-2-4-11(12)13(15)8-6-10(14)7-9-13/h2-8,16H,9,14-15H2,1H3.
What are the key properties of 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine?
4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine has a molecular weight of 215.30 g/mol, XLogP of 1.68, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(methylamino)phenyl]cyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 174573107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).