About [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate
[6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate (PubChem CID 174573803) has the molecular formula C14H20ClN3O4Si
and a molecular weight of 357.87 g/mol. Its IUPAC name is [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate.
Molecular Properties
| Compound Name | [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate |
| PubChem CID | 174573803 |
| Molecular Formula | C14H20ClN3O4Si |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate |
| SMILES | CC(=O)Oc1c(Cl)n(COCC[Si](C)(C)C)c2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C14H20ClN3O4Si/c1-9(19)22-12-10-11(14(20)17-7-16-10)18(13(12)15)8-21-5-6-23(2,3)4/h7H,5-6,8H2,1-4H3,(H,16,17,20) |
| InChIKey | CCFQIYCJGNYUNP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate?
The IUPAC name of [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate (CID 174573803) is [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate.
What is the SMILES notation for [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate?
The canonical SMILES for [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate is CC(=O)Oc1c(Cl)n(COCC[Si](C)(C)C)c2c(=O)[nH]cnc12.
What is the InChIKey of [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate?
The InChIKey is CCFQIYCJGNYUNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3O4Si/c1-9(19)22-12-10-11(14(20)17-7-16-10)18(13(12)15)8-21-5-6-23(2,3)4/h7H,5-6,8H2,1-4H3,(H,16,17,20).
What are the key properties of [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate?
[6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate has a molecular weight of 357.87 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-oxo-5-(2-trimethylsilylethoxymethyl)-3H-pyrrolo[3,2-d]pyrimidin-7-yl] acetate is sourced from PubChem (CID 174573803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).