C26H29N3OS — CID 174573883
6-[4-[(3R)-3-(dimethylamino)butanimidoyl]phenyl]-2-(4-methylphenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-one (PubChem CID 174573883) has the molecular formula C26H29N3OS and a molecular weight of 431.61 g/mol. Its IUPAC name is 6-[4-[(3R)-3-(dimethylamino)butanimidoyl]phenyl]-2-(4-methylphenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-one.
| Compound Name | 6-[4-[(3R)-3-(dimethylamino)butanimidoyl]phenyl]-2-(4-methylphenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 174573883 |
| Molecular Formula | C26H29N3OS |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 6-[4-[(3R)-3-(dimethylamino)butanimidoyl]phenyl]-2-(4-methylphenyl)-4,5-dihydrothieno[2,3-c]pyridin-7-one |
| SMILES | [H]/N=C(\C[C@@H](C)N(C)C)c1ccc(N2CCc3cc(-c4ccc(C)cc4)sc3C2=O)cc1 |
| InChI | InChI=1S/C26H29N3OS/c1-17-5-7-20(8-6-17)24-16-21-13-14-29(26(30)25(21)31-24)22-11-9-19(10-12-22)23(27)15-18(2)28(3)4/h5-12,16,18,27H,13-15H2,1-4H3/b27-23+/t18-/m1/s1 |
| InChIKey | ZCEJURKCTZTRNH-QZBDRJEFSA-N |
| XLogP | 5.63 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|