About 2-butyl-6-pentyl-6H-1,3-thiazine
2-butyl-6-pentyl-6H-1,3-thiazine (PubChem CID 174574002) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is 2-butyl-6-pentyl-6H-1,3-thiazine.
Molecular Properties
| Compound Name | 2-butyl-6-pentyl-6H-1,3-thiazine |
| PubChem CID | 174574002 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 2-butyl-6-pentyl-6H-1,3-thiazine |
| SMILES | CCCCCC1C=CN=C(CCCC)S1 |
| InChI | InChI=1S/C13H23NS/c1-3-5-7-8-12-10-11-14-13(15-12)9-6-4-2/h10-12H,3-9H2,1-2H3 |
| InChIKey | IOSHNNCIWMESSP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-6-pentyl-6H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-pentyl-6H-1,3-thiazine?
The IUPAC name of 2-butyl-6-pentyl-6H-1,3-thiazine (CID 174574002) is 2-butyl-6-pentyl-6H-1,3-thiazine.
What is the SMILES notation for 2-butyl-6-pentyl-6H-1,3-thiazine?
The canonical SMILES for 2-butyl-6-pentyl-6H-1,3-thiazine is CCCCCC1C=CN=C(CCCC)S1.
What is the InChIKey of 2-butyl-6-pentyl-6H-1,3-thiazine?
The InChIKey is IOSHNNCIWMESSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NS/c1-3-5-7-8-12-10-11-14-13(15-12)9-6-4-2/h10-12H,3-9H2,1-2H3.
What are the key properties of 2-butyl-6-pentyl-6H-1,3-thiazine?
2-butyl-6-pentyl-6H-1,3-thiazine has a molecular weight of 225.40 g/mol, XLogP of 4.78, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-pentyl-6H-1,3-thiazine is sourced from PubChem (CID 174574002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).