About 2-bromo-1,3-dichlorobenzene;formaldehyde
2-bromo-1,3-dichlorobenzene;formaldehyde (PubChem CID 174574164) has the molecular formula C7H5BrCl2O
and a molecular weight of 255.93 g/mol. Its IUPAC name is 2-bromo-1,3-dichlorobenzene;formaldehyde.
Molecular Properties
| Compound Name | 2-bromo-1,3-dichlorobenzene;formaldehyde |
| PubChem CID | 174574164 |
| Molecular Formula | C7H5BrCl2O |
| Molecular Weight | 255.93 g/mol |
| Exact Mass | 253.89 |
| IUPAC Name | 2-bromo-1,3-dichlorobenzene;formaldehyde |
| SMILES | C=O.Clc1cccc(Cl)c1Br |
| InChI | InChI=1S/C6H3BrCl2.CH2O/c7-6-4(8)2-1-3-5(6)9;1-2/h1-3H;1H2 |
| InChIKey | PNPZEYMYVSZFFL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.93 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-dichlorobenzene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-dichlorobenzene;formaldehyde?
The IUPAC name of 2-bromo-1,3-dichlorobenzene;formaldehyde (CID 174574164) is 2-bromo-1,3-dichlorobenzene;formaldehyde.
What is the SMILES notation for 2-bromo-1,3-dichlorobenzene;formaldehyde?
The canonical SMILES for 2-bromo-1,3-dichlorobenzene;formaldehyde is C=O.Clc1cccc(Cl)c1Br.
What is the InChIKey of 2-bromo-1,3-dichlorobenzene;formaldehyde?
The InChIKey is PNPZEYMYVSZFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrCl2.CH2O/c7-6-4(8)2-1-3-5(6)9;1-2/h1-3H;1H2.
What are the key properties of 2-bromo-1,3-dichlorobenzene;formaldehyde?
2-bromo-1,3-dichlorobenzene;formaldehyde has a molecular weight of 255.93 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-dichlorobenzene;formaldehyde is sourced from PubChem (CID 174574164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).