About 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride
4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride (PubChem CID 174574194) has the molecular formula C14H28ClN3O4
and a molecular weight of 337.85 g/mol. Its IUPAC name is 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride.
Molecular Properties
| Compound Name | 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride |
| PubChem CID | 174574194 |
| Molecular Formula | C14H28ClN3O4 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride |
| SMILES | Cl.NC=O.NC=O.O=C(O)C1(C2CCCCC2)CCNCC1 |
| InChI | InChI=1S/C12H21NO2.2CH3NO.ClH/c14-11(15)12(6-8-13-9-7-12)10-4-2-1-3-5-10;2*2-1-3;/h10,13H,1-9H2,(H,14,15);2*1H,(H2,2,3);1H |
| InChIKey | RGEZCZGFAUNVMI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride?
The IUPAC name of 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride (CID 174574194) is 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride.
What is the SMILES notation for 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride?
The canonical SMILES for 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride is Cl.NC=O.NC=O.O=C(O)C1(C2CCCCC2)CCNCC1.
What is the InChIKey of 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride?
The InChIKey is RGEZCZGFAUNVMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO2.2CH3NO.ClH/c14-11(15)12(6-8-13-9-7-12)10-4-2-1-3-5-10;2*2-1-3;/h10,13H,1-9H2,(H,14,15);2*1H,(H2,2,3);1H.
What are the key properties of 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride?
4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride has a molecular weight of 337.85 g/mol, XLogP of 0.65, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylpiperidine-4-carboxylic acid;formamide;hydrochloride is sourced from PubChem (CID 174574194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).