C17H28N2O5S — CID 174574426
azane;2,3,4,6-tetramethyl-5-[3-(2-methylprop-2-enoylamino)oxypropyl]benzenesulfonic acid (PubChem CID 174574426) has the molecular formula C17H28N2O5S and a molecular weight of 372.49 g/mol. Its IUPAC name is azane;2,3,4,6-tetramethyl-5-[3-(2-methylprop-2-enoylamino)oxypropyl]benzenesulfonic acid.
| Compound Name | azane;2,3,4,6-tetramethyl-5-[3-(2-methylprop-2-enoylamino)oxypropyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 174574426 |
| Molecular Formula | C17H28N2O5S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | azane;2,3,4,6-tetramethyl-5-[3-(2-methylprop-2-enoylamino)oxypropyl]benzenesulfonic acid |
| SMILES | C=C(C)C(=O)NOCCCc1c(C)c(C)c(C)c(S(=O)(=O)O)c1C.N |
| InChI | InChI=1S/C17H25NO5S.H3N/c1-10(2)17(19)18-23-9-7-8-15-12(4)11(3)13(5)16(14(15)6)24(20,21)22;/h1,7-9H2,2-6H3,(H,18,19)(H,20,21,22);1H3 |
| InChIKey | XJLPHRLLWJYSPF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 127.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|