About 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid
6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid (PubChem CID 174574954) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid.
Molecular Properties
| Compound Name | 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid |
| PubChem CID | 174574954 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid |
| SMILES | CC(CC=C(O)CC(=O)O)N1C=NCC1 |
| InChI | InChI=1S/C10H16N2O3/c1-8(12-5-4-11-7-12)2-3-9(13)6-10(14)15/h3,7-8,13H,2,4-6H2,1H3,(H,14,15) |
| InChIKey | MVGNREFFHOWJEH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid?
The IUPAC name of 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid (CID 174574954) is 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid.
What is the SMILES notation for 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid?
The canonical SMILES for 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid is CC(CC=C(O)CC(=O)O)N1C=NCC1.
What is the InChIKey of 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid?
The InChIKey is MVGNREFFHOWJEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-8(12-5-4-11-7-12)2-3-9(13)6-10(14)15/h3,7-8,13H,2,4-6H2,1H3,(H,14,15).
What are the key properties of 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid?
6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid has a molecular weight of 212.25 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,5-dihydroimidazol-1-yl)-3-hydroxyhept-3-enoic acid is sourced from PubChem (CID 174574954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).