About 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol
2-(21,22-dihydroporphyrin-2-ylmethyl)phenol (PubChem CID 174575023) has the molecular formula C27H20N4O
and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol.
Molecular Properties
| Compound Name | 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol |
| PubChem CID | 174575023 |
| Molecular Formula | C27H20N4O |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol |
| SMILES | Oc1ccccc1Cc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3 |
| InChI | InChI=1S/C27H20N4O/c32-27-4-2-1-3-17(27)11-18-12-25-15-23-8-7-21(29-23)13-19-5-6-20(28-19)14-22-9-10-24(30-22)16-26(18)31-25/h1-10,12-16,29,31-32H,11H2/b19-13-,20-14-,21-13-,22-14-,23-15-,24-16-,25-15-,26-16- |
| InChIKey | MTELYPJTPZZEPS-VCXGEGJLSA-N |
| XLogP | 5.95 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol?
The IUPAC name of 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol (CID 174575023) is 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol.
What is the SMILES notation for 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol?
The canonical SMILES for 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol is Oc1ccccc1Cc1cc2cc3ccc(cc4nc(cc5nc(cc1[nH]2)C=C5)C=C4)[nH]3.
What is the InChIKey of 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol?
The InChIKey is MTELYPJTPZZEPS-VCXGEGJLSA-N. The full InChI is InChI=1S/C27H20N4O/c32-27-4-2-1-3-17(27)11-18-12-25-15-23-8-7-21(29-23)13-19-5-6-20(28-19)14-22-9-10-24(30-22)16-26(18)31-25/h1-10,12-16,29,31-32H,11H2/b19-13-,20-14-,21-13-,22-14-,23-15-,24-16-,25-15-,26-16-.
What are the key properties of 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol?
2-(21,22-dihydroporphyrin-2-ylmethyl)phenol has a molecular weight of 416.48 g/mol, XLogP of 5.95, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(21,22-dihydroporphyrin-2-ylmethyl)phenol is sourced from PubChem (CID 174575023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).