C33H31BrO3S — CID 174576423
2-[3-(4-bromophenyl)prop-2-enylsulfonylmethyl]-1,2,3,4-tetrahydrochrysene;2H-pyran (PubChem CID 174576423) has the molecular formula C33H31BrO3S and a molecular weight of 587.58 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)prop-2-enylsulfonylmethyl]-1,2,3,4-tetrahydrochrysene;2H-pyran.
| Compound Name | 2-[3-(4-bromophenyl)prop-2-enylsulfonylmethyl]-1,2,3,4-tetrahydrochrysene;2H-pyran |
|---|---|
| PubChem CID | 174576423 |
| Molecular Formula | C33H31BrO3S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | 2-[3-(4-bromophenyl)prop-2-enylsulfonylmethyl]-1,2,3,4-tetrahydrochrysene;2H-pyran |
| SMILES | C1=CCOC=C1.O=S(=O)(CC=Cc1ccc(Br)cc1)CC1CCc2c(ccc3c2ccc2ccccc23)C1 |
| InChI | InChI=1S/C28H25BrO2S.C5H6O/c29-24-12-7-20(8-13-24)4-3-17-32(30,31)19-21-9-14-26-23(18-21)11-16-27-25-6-2-1-5-22(25)10-15-28(26)27;1-2-4-6-5-3-1/h1-8,10-13,15-16,21H,9,14,17-19H2;1-4H,5H2 |
| InChIKey | CBUUYYLDNJEOKE-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|