About tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate
tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate (PubChem CID 174577051) has the molecular formula C20H31NO4
and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate |
| PubChem CID | 174577051 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate |
| SMILES | CC(CN(Cc1ccccc1)C(=O)OC(C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C20H31NO4/c1-15(17-14-23-20(5,6)24-17)12-21(18(22)25-19(2,3)4)13-16-10-8-7-9-11-16/h7-11,15,17H,12-14H2,1-6H3 |
| InChIKey | BGOUQBDILUALBY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate?
The IUPAC name of tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate (CID 174577051) is tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate.
What is the SMILES notation for tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate?
The canonical SMILES for tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate is CC(CN(Cc1ccccc1)C(=O)OC(C)(C)C)C1COC(C)(C)O1.
What is the InChIKey of tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate?
The InChIKey is BGOUQBDILUALBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO4/c1-15(17-14-23-20(5,6)24-17)12-21(18(22)25-19(2,3)4)13-16-10-8-7-9-11-16/h7-11,15,17H,12-14H2,1-6H3.
What are the key properties of tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate?
tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate has a molecular weight of 349.47 g/mol, XLogP of 4.21, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-benzyl-N-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)propyl]carbamate is sourced from PubChem (CID 174577051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).