C10H11ClF3NO — CID 174577868
(2R)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 174577868) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is (2R)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | (2R)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 174577868 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (2R)-1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | C[C@@H](O)Cc1cc(Cl)c(N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H11ClF3NO/c1-5(16)2-6-3-7(10(12,13)14)9(15)8(11)4-6/h3-5,16H,2,15H2,1H3/t5-/m1/s1 |
| InChIKey | UEXLMCXBYDMMOO-RXMQYKEDSA-N |
| XLogP | 2.86 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|