About acetic acid;bis(ethenyl) dodecanedioate
acetic acid;bis(ethenyl) dodecanedioate (PubChem CID 174577990) has the molecular formula C18H30O6
and a molecular weight of 342.43 g/mol. Its IUPAC name is acetic acid;bis(ethenyl) dodecanedioate.
Molecular Properties
| Compound Name | acetic acid;bis(ethenyl) dodecanedioate |
| PubChem CID | 174577990 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | acetic acid;bis(ethenyl) dodecanedioate |
| SMILES | C=COC(=O)CCCCCCCCCCC(=O)OC=C.CC(=O)O |
| InChI | InChI=1S/C16H26O4.C2H4O2/c1-3-19-15(17)13-11-9-7-5-6-8-10-12-14-16(18)20-4-2;1-2(3)4/h3-4H,1-2,5-14H2;1H3,(H,3,4) |
| InChIKey | GLZRVKYDWLUYCS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;bis(ethenyl) dodecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;bis(ethenyl) dodecanedioate?
The IUPAC name of acetic acid;bis(ethenyl) dodecanedioate (CID 174577990) is acetic acid;bis(ethenyl) dodecanedioate.
What is the SMILES notation for acetic acid;bis(ethenyl) dodecanedioate?
The canonical SMILES for acetic acid;bis(ethenyl) dodecanedioate is C=COC(=O)CCCCCCCCCCC(=O)OC=C.CC(=O)O.
What is the InChIKey of acetic acid;bis(ethenyl) dodecanedioate?
The InChIKey is GLZRVKYDWLUYCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4.C2H4O2/c1-3-19-15(17)13-11-9-7-5-6-8-10-12-14-16(18)20-4-2;1-2(3)4/h3-4H,1-2,5-14H2;1H3,(H,3,4).
What are the key properties of acetic acid;bis(ethenyl) dodecanedioate?
acetic acid;bis(ethenyl) dodecanedioate has a molecular weight of 342.43 g/mol, XLogP of 4.35, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;bis(ethenyl) dodecanedioate is sourced from PubChem (CID 174577990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).