C21H24N2O7S2 — CID 174578471
3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propyl naphthalene-1-sulfonate (PubChem CID 174578471) has the molecular formula C21H24N2O7S2 and a molecular weight of 480.56 g/mol. Its IUPAC name is 3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propyl naphthalene-1-sulfonate.
| Compound Name | 3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propyl naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 174578471 |
| Molecular Formula | C21H24N2O7S2 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 3-[3-hydroxy-4-(1,1,4-trihydroxy-1,2,5-thiadiazolidin-2-yl)phenyl]propyl naphthalene-1-sulfonate |
| SMILES | O=S(=O)(OCCCc1ccc(N2CC(O)NS2(O)O)c(O)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H24N2O7S2/c24-19-13-15(10-11-18(19)23-14-21(25)22-32(23,28)29)5-4-12-30-31(26,27)20-9-3-7-16-6-1-2-8-17(16)20/h1-3,6-11,13,21-22,24-25,28-29H,4-5,12,14H2 |
| InChIKey | VTPZGFIBRJGNKM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 139.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|