C11H12N2O4S — CID 174578515
5-(4-ethenyl-2-hydroxyphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde (PubChem CID 174578515) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 5-(4-ethenyl-2-hydroxyphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde.
| Compound Name | 5-(4-ethenyl-2-hydroxyphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 174578515 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-(4-ethenyl-2-hydroxyphenyl)-1,1-dioxo-1,2,5-thiadiazolidine-3-carbaldehyde |
| SMILES | C=Cc1ccc(N2CC(C=O)NS2(=O)=O)c(O)c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-2-8-3-4-10(11(15)5-8)13-6-9(7-14)12-18(13,16)17/h2-5,7,9,12,15H,1,6H2 |
| InChIKey | XQEFSWGMIWCCBJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|