About [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate
[8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate (PubChem CID 174579055) has the molecular formula C12H13N2O4S-
and a molecular weight of 281.31 g/mol. Its IUPAC name is [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate.
Molecular Properties
| Compound Name | [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate |
| PubChem CID | 174579055 |
| Molecular Formula | C12H13N2O4S- |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate |
| SMILES | O=C(O)Nc1ccc2c(c1)N=C(CS(=O)[O-])CCC2 |
| InChI | InChI=1S/C12H14N2O4S/c15-12(16)14-9-5-4-8-2-1-3-10(7-19(17)18)13-11(8)6-9/h4-6,14H,1-3,7H2,(H,15,16)(H,17,18)/p-1 |
| InChIKey | AQOFBVWUIYWVBD-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate?
The IUPAC name of [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate (CID 174579055) is [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate.
What is the SMILES notation for [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate?
The canonical SMILES for [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate is O=C(O)Nc1ccc2c(c1)N=C(CS(=O)[O-])CCC2.
What is the InChIKey of [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate?
The InChIKey is AQOFBVWUIYWVBD-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H14N2O4S/c15-12(16)14-9-5-4-8-2-1-3-10(7-19(17)18)13-11(8)6-9/h4-6,14H,1-3,7H2,(H,15,16)(H,17,18)/p-1.
What are the key properties of [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate?
[8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate has a molecular weight of 281.31 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(carboxyamino)-4,5-dihydro-3H-1-benzazepin-2-yl]methanesulfinate is sourced from PubChem (CID 174579055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).