C8H12BrN3O2S — CID 174579693
tert-butyl N-amino-N-(4-bromo-1,3-thiazol-2-yl)carbamate (PubChem CID 174579693) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is tert-butyl N-amino-N-(4-bromo-1,3-thiazol-2-yl)carbamate.
| Compound Name | tert-butyl N-amino-N-(4-bromo-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 174579693 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | tert-butyl N-amino-N-(4-bromo-1,3-thiazol-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(N)c1nc(Br)cs1 |
| InChI | InChI=1S/C8H12BrN3O2S/c1-8(2,3)14-7(13)12(10)6-11-5(9)4-15-6/h4H,10H2,1-3H3 |
| InChIKey | XKUSVVMMTXROJP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|