C9H10BrNO4S — CID 174580484
5-bromo-2-(methanesulfonamidomethyl)benzoic acid (PubChem CID 174580484) has the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. Its IUPAC name is 5-bromo-2-(methanesulfonamidomethyl)benzoic acid.
| Compound Name | 5-bromo-2-(methanesulfonamidomethyl)benzoic acid |
|---|---|
| PubChem CID | 174580484 |
| Molecular Formula | C9H10BrNO4S |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 5-bromo-2-(methanesulfonamidomethyl)benzoic acid |
| SMILES | CS(=O)(=O)NCc1ccc(Br)cc1C(=O)O |
| InChI | InChI=1S/C9H10BrNO4S/c1-16(14,15)11-5-6-2-3-7(10)4-8(6)9(12)13/h2-4,11H,5H2,1H3,(H,12,13) |
| InChIKey | ROSUGYMVFYXRGW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |