About 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide
3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide (PubChem CID 17458159) has the molecular formula C21H24N4O2
and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide.
Molecular Properties
| Compound Name | 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide |
| PubChem CID | 17458159 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide |
| SMILES | CNC(=O)c1nn(CN(C)Cc2ccc(C)cc2C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H24N4O2/c1-14-9-10-16(15(2)11-14)12-24(4)13-25-21(27)18-8-6-5-7-17(18)19(23-25)20(26)22-3/h5-11H,12-13H2,1-4H3,(H,22,26) |
| InChIKey | DGJDMXGUMURGGJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide?
The IUPAC name of 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide (CID 17458159) is 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide.
What is the SMILES notation for 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide?
The canonical SMILES for 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide is CNC(=O)c1nn(CN(C)Cc2ccc(C)cc2C)c(=O)c2ccccc12.
What is the InChIKey of 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide?
The InChIKey is DGJDMXGUMURGGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O2/c1-14-9-10-16(15(2)11-14)12-24(4)13-25-21(27)18-8-6-5-7-17(18)19(23-25)20(26)22-3/h5-11H,12-13H2,1-4H3,(H,22,26).
What are the key properties of 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide?
3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide has a molecular weight of 364.45 g/mol, XLogP of 2.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2,4-dimethylphenyl)methyl-methylamino]methyl]-N-methyl-4-oxophthalazine-1-carboxamide is sourced from PubChem (CID 17458159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).