About ruthenium;2,3,4-triethyl-1H-pyrrole
ruthenium;2,3,4-triethyl-1H-pyrrole (PubChem CID 174581947) has the molecular formula C10H17NRu
and a molecular weight of 252.32 g/mol. Its IUPAC name is ruthenium;2,3,4-triethyl-1H-pyrrole.
Molecular Properties
| Compound Name | ruthenium;2,3,4-triethyl-1H-pyrrole |
| PubChem CID | 174581947 |
| Molecular Formula | C10H17NRu |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | ruthenium;2,3,4-triethyl-1H-pyrrole |
| SMILES | CCc1c[nH]c(CC)c1CC.[Ru] |
| InChI | InChI=1S/C10H17N.Ru/c1-4-8-7-11-10(6-3)9(8)5-2;/h7,11H,4-6H2,1-3H3; |
| InChIKey | ZIKGQBBLMAJVOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ruthenium;2,3,4-triethyl-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ruthenium;2,3,4-triethyl-1H-pyrrole?
The IUPAC name of ruthenium;2,3,4-triethyl-1H-pyrrole (CID 174581947) is ruthenium;2,3,4-triethyl-1H-pyrrole.
What is the SMILES notation for ruthenium;2,3,4-triethyl-1H-pyrrole?
The canonical SMILES for ruthenium;2,3,4-triethyl-1H-pyrrole is CCc1c[nH]c(CC)c1CC.[Ru].
What is the InChIKey of ruthenium;2,3,4-triethyl-1H-pyrrole?
The InChIKey is ZIKGQBBLMAJVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.Ru/c1-4-8-7-11-10(6-3)9(8)5-2;/h7,11H,4-6H2,1-3H3;.
What are the key properties of ruthenium;2,3,4-triethyl-1H-pyrrole?
ruthenium;2,3,4-triethyl-1H-pyrrole has a molecular weight of 252.32 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ruthenium;2,3,4-triethyl-1H-pyrrole is sourced from PubChem (CID 174581947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).