About 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine
2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine (PubChem CID 174582169) has the molecular formula C19H23NOS
and a molecular weight of 313.47 g/mol. Its IUPAC name is 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine |
| PubChem CID | 174582169 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine |
| SMILES | CN1C(c2ccccc2)COC1(C)SCCc1ccccc1 |
| InChI | InChI=1S/C19H23NOS/c1-19(22-14-13-16-9-5-3-6-10-16)20(2)18(15-21-19)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3 |
| InChIKey | LQFMBABZLICFTL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine?
The IUPAC name of 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine (CID 174582169) is 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine.
What is the SMILES notation for 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine?
The canonical SMILES for 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine is CN1C(c2ccccc2)COC1(C)SCCc1ccccc1.
What is the InChIKey of 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine?
The InChIKey is LQFMBABZLICFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NOS/c1-19(22-14-13-16-9-5-3-6-10-16)20(2)18(15-21-19)17-11-7-4-8-12-17/h3-12,18H,13-15H2,1-2H3.
What are the key properties of 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine?
2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine has a molecular weight of 313.47 g/mol, XLogP of 4.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-phenyl-2-(2-phenylethylsulfanyl)-1,3-oxazolidine is sourced from PubChem (CID 174582169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).