About methanesulfonic acid;2-sulfanylcyclohexan-1-one
methanesulfonic acid;2-sulfanylcyclohexan-1-one (PubChem CID 174582481) has the molecular formula C7H14O4S2
and a molecular weight of 226.32 g/mol. Its IUPAC name is methanesulfonic acid;2-sulfanylcyclohexan-1-one.
Molecular Properties
| Compound Name | methanesulfonic acid;2-sulfanylcyclohexan-1-one |
| PubChem CID | 174582481 |
| Molecular Formula | C7H14O4S2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | methanesulfonic acid;2-sulfanylcyclohexan-1-one |
| SMILES | CS(=O)(=O)O.O=C1CCCCC1S |
| InChI | InChI=1S/C6H10OS.CH4O3S/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h6,8H,1-4H2;1H3,(H,2,3,4) |
| InChIKey | ATYBVZRLTBYHTJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;2-sulfanylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;2-sulfanylcyclohexan-1-one?
The IUPAC name of methanesulfonic acid;2-sulfanylcyclohexan-1-one (CID 174582481) is methanesulfonic acid;2-sulfanylcyclohexan-1-one.
What is the SMILES notation for methanesulfonic acid;2-sulfanylcyclohexan-1-one?
The canonical SMILES for methanesulfonic acid;2-sulfanylcyclohexan-1-one is CS(=O)(=O)O.O=C1CCCCC1S.
What is the InChIKey of methanesulfonic acid;2-sulfanylcyclohexan-1-one?
The InChIKey is ATYBVZRLTBYHTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS.CH4O3S/c7-5-3-1-2-4-6(5)8;1-5(2,3)4/h6,8H,1-4H2;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;2-sulfanylcyclohexan-1-one?
methanesulfonic acid;2-sulfanylcyclohexan-1-one has a molecular weight of 226.32 g/mol, XLogP of 0.93, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;2-sulfanylcyclohexan-1-one is sourced from PubChem (CID 174582481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).