About 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid
1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid (PubChem CID 174583344) has the molecular formula C25H27F3O3S2
and a molecular weight of 496.62 g/mol. Its IUPAC name is 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid |
| PubChem CID | 174583344 |
| Molecular Formula | C25H27F3O3S2 |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.S.c1ccc(-c2ccccc2-c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H24.CHF3O3S.H2S/c1-3-9-19(10-4-1)20-15-17-22(18-16-20)24-14-8-7-13-23(24)21-11-5-2-6-12-21;2-1(3,4)8(5,6)7;/h2,5-8,11-19H,1,3-4,9-10H2;(H,5,6,7);1H2 |
| InChIKey | MJWTUVVZZZBCAY-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid?
The IUPAC name of 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid (CID 174583344) is 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid?
The canonical SMILES for 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid is O=S(=O)(O)C(F)(F)F.S.c1ccc(-c2ccccc2-c2ccc(C3CCCCC3)cc2)cc1.
What is the InChIKey of 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid?
The InChIKey is MJWTUVVZZZBCAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24.CHF3O3S.H2S/c1-3-9-19(10-4-1)20-15-17-22(18-16-20)24-14-8-7-13-23(24)21-11-5-2-6-12-21;2-1(3,4)8(5,6)7;/h2,5-8,11-19H,1,3-4,9-10H2;(H,5,6,7);1H2.
What are the key properties of 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid?
1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid has a molecular weight of 496.62 g/mol, XLogP of 7.58, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-(2-phenylphenyl)benzene;sulfane;trifluoromethanesulfonic acid is sourced from PubChem (CID 174583344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).