C12H12ClFOS — CID 174584446
5-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-one (PubChem CID 174584446) has the molecular formula C12H12ClFOS and a molecular weight of 258.75 g/mol. Its IUPAC name is 5-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-one.
| Compound Name | 5-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-one |
|---|---|
| PubChem CID | 174584446 |
| Molecular Formula | C12H12ClFOS |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-[(3-chloro-4-fluorophenyl)methyl]-2-methylthiolan-3-one |
| SMILES | CC1SC(Cc2ccc(F)c(Cl)c2)CC1=O |
| InChI | InChI=1S/C12H12ClFOS/c1-7-12(15)6-9(16-7)4-8-2-3-11(14)10(13)5-8/h2-3,5,7,9H,4,6H2,1H3 |
| InChIKey | BXBVFRQNWZKTDW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |