About [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate
[3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate (PubChem CID 174584643) has the molecular formula C14H13FN2O2
and a molecular weight of 260.27 g/mol. Its IUPAC name is [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate.
Molecular Properties
| Compound Name | [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate |
| PubChem CID | 174584643 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate |
| SMILES | CC(=O)Oc1cncn1C1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C14H13FN2O2/c1-9(18)19-14-7-16-8-17(14)13-5-2-10-6-11(15)3-4-12(10)13/h3-4,6-8,13H,2,5H2,1H3 |
| InChIKey | KXZGINFJTNSSHU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate?
The IUPAC name of [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate (CID 174584643) is [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate.
What is the SMILES notation for [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate?
The canonical SMILES for [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate is CC(=O)Oc1cncn1C1CCc2cc(F)ccc21.
What is the InChIKey of [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate?
The InChIKey is KXZGINFJTNSSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O2/c1-9(18)19-14-7-16-8-17(14)13-5-2-10-6-11(15)3-4-12(10)13/h3-4,6-8,13H,2,5H2,1H3.
What are the key properties of [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate?
[3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate has a molecular weight of 260.27 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-fluoro-2,3-dihydro-1H-inden-1-yl)imidazol-4-yl] acetate is sourced from PubChem (CID 174584643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).