About hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene
hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene (PubChem CID 174584647) has the molecular formula C17H40NO+
and a molecular weight of 274.51 g/mol. Its IUPAC name is hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene.
Molecular Properties
| Compound Name | hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene |
| PubChem CID | 174584647 |
| Molecular Formula | C17H40NO+ |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 274.31 |
| IUPAC Name | hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene |
| SMILES | C=CC.CCCCCC[N+](C)(C)C.CCCCCO |
| InChI | InChI=1S/C9H22N.C5H12O.C3H6/c1-5-6-7-8-9-10(2,3)4;1-2-3-4-5-6;1-3-2/h5-9H2,1-4H3;6H,2-5H2,1H3;3H,1H2,2H3/q+1;; |
| InChIKey | MBGWBLHDOASARE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene?
The IUPAC name of hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene (CID 174584647) is hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene.
What is the SMILES notation for hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene?
The canonical SMILES for hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene is C=CC.CCCCCC[N+](C)(C)C.CCCCCO.
What is the InChIKey of hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene?
The InChIKey is MBGWBLHDOASARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N.C5H12O.C3H6/c1-5-6-7-8-9-10(2,3)4;1-2-3-4-5-6;1-3-2/h5-9H2,1-4H3;6H,2-5H2,1H3;3H,1H2,2H3/q+1;;.
What are the key properties of hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene?
hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene has a molecular weight of 274.51 g/mol, XLogP of 4.63, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl(trimethyl)azanium;pentan-1-ol;prop-1-ene is sourced from PubChem (CID 174584647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).